methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate

C10H8N2O3 — CID 83832388

IUPACmethyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate
SMILESCOC(=O)c1cccn2cnc(C=O)c12
InChIInChI=1S/C10H8N2O3/c1-15-10(14)7-3-2-4-12-6-11-8(5-13)9(7)12/h2-6H,1H3
InChIKeyBYRFVSGGNGQJHJ-UHFFFAOYSA-N
MW204.19 g/mol
LogP0.93
Rot. Bonds2

About methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate

methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate (PubChem CID 83832388) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate.

Molecular Properties

Compound Namemethyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate
PubChem CID83832388
Molecular FormulaC10H8N2O3
Molecular Weight204.19 g/mol
Exact Mass204.05
IUPAC Namemethyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate
SMILESCOC(=O)c1cccn2cnc(C=O)c12
InChIInChI=1S/C10H8N2O3/c1-15-10(14)7-3-2-4-12-6-11-8(5-13)9(7)12/h2-6H,1H3
InChIKeyBYRFVSGGNGQJHJ-UHFFFAOYSA-N
XLogP0.93
TPSA60.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.19
LogP ≤ 50.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate?
The IUPAC name of methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate (CID 83832388) is methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate.
What is the SMILES notation for methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate?
The canonical SMILES for methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate is COC(=O)c1cccn2cnc(C=O)c12.
What is the InChIKey of methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate?
The InChIKey is BYRFVSGGNGQJHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c1-15-10(14)7-3-2-4-12-6-11-8(5-13)9(7)12/h2-6H,1H3.
What are the key properties of methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate?
methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate has a molecular weight of 204.19 g/mol, XLogP of 0.93, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-formylimidazo[1,5-a]pyridine-8-carboxylate is sourced from PubChem (CID 83832388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).