C11H14N2O2 — CID 83833341
2-amino-2-(5,6,7,8-tetrahydroquinolin-3-yl)acetic acid (PubChem CID 83833341) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-amino-2-(5,6,7,8-tetrahydroquinolin-3-yl)acetic acid.
| Compound Name | 2-amino-2-(5,6,7,8-tetrahydroquinolin-3-yl)acetic acid |
|---|---|
| PubChem CID | 83833341 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-amino-2-(5,6,7,8-tetrahydroquinolin-3-yl)acetic acid |
| SMILES | NC(C(=O)O)c1cnc2c(c1)CCCC2 |
| InChI | InChI=1S/C11H14N2O2/c12-10(11(14)15)8-5-7-3-1-2-4-9(7)13-6-8/h5-6,10H,1-4,12H2,(H,14,15) |
| InChIKey | LCPQYMJVWVNVIY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |