C13H17NO2 — CID 83837155
3-amino-3-(3-cyclobutylphenyl)propanoic acid (PubChem CID 83837155) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-amino-3-(3-cyclobutylphenyl)propanoic acid.
| Compound Name | 3-amino-3-(3-cyclobutylphenyl)propanoic acid |
|---|---|
| PubChem CID | 83837155 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-amino-3-(3-cyclobutylphenyl)propanoic acid |
| SMILES | NC(CC(=O)O)c1cccc(C2CCC2)c1 |
| InChI | InChI=1S/C13H17NO2/c14-12(8-13(15)16)11-6-2-5-10(7-11)9-3-1-4-9/h2,5-7,9,12H,1,3-4,8,14H2,(H,15,16) |
| InChIKey | UKNRLRWVTLNVCY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |