C13H22N4O2 — CID 838403
N-cyclohexyl-4,6-diethoxy-1,3,5-triazin-2-amine (PubChem CID 838403) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-cyclohexyl-4,6-diethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-cyclohexyl-4,6-diethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 838403 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N-cyclohexyl-4,6-diethoxy-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(NC2CCCCC2)nc(OCC)n1 |
| InChI | InChI=1S/C13H22N4O2/c1-3-18-12-15-11(16-13(17-12)19-4-2)14-10-8-6-5-7-9-10/h10H,3-9H2,1-2H3,(H,14,15,16,17) |
| InChIKey | UHTQJHNBSNZXGS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |