C13H18N4 — CID 83840549
3-methyl-5-(piperazin-1-ylmethyl)imidazo[1,5-a]pyridine (PubChem CID 83840549) has the molecular formula C13H18N4 and a molecular weight of 230.32 g/mol. Its IUPAC name is 3-methyl-5-(piperazin-1-ylmethyl)imidazo[1,5-a]pyridine.
| Compound Name | 3-methyl-5-(piperazin-1-ylmethyl)imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 83840549 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-methyl-5-(piperazin-1-ylmethyl)imidazo[1,5-a]pyridine |
| SMILES | Cc1ncc2cccc(CN3CCNCC3)n12 |
| InChI | InChI=1S/C13H18N4/c1-11-15-9-12-3-2-4-13(17(11)12)10-16-7-5-14-6-8-16/h2-4,9,14H,5-8,10H2,1H3 |
| InChIKey | JJNRBPTYOIKMLK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |