C10H12BrN3 — CID 83843959
1-(5-bromo-2-methylimidazo[1,2-a]pyridin-3-yl)ethanamine (PubChem CID 83843959) has the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. Its IUPAC name is 1-(5-bromo-2-methylimidazo[1,2-a]pyridin-3-yl)ethanamine.
| Compound Name | 1-(5-bromo-2-methylimidazo[1,2-a]pyridin-3-yl)ethanamine |
|---|---|
| PubChem CID | 83843959 |
| Molecular Formula | C10H12BrN3 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 1-(5-bromo-2-methylimidazo[1,2-a]pyridin-3-yl)ethanamine |
| SMILES | Cc1nc2cccc(Br)n2c1C(C)N |
| InChI | InChI=1S/C10H12BrN3/c1-6(12)10-7(2)13-9-5-3-4-8(11)14(9)10/h3-6H,12H2,1-2H3 |
| InChIKey | OKNQZNFIBMMZIF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|