C12H14BrNO — CID 83844673
3-bromo-4-(1-methylpyrrolidin-3-yl)benzaldehyde (PubChem CID 83844673) has the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. Its IUPAC name is 3-bromo-4-(1-methylpyrrolidin-3-yl)benzaldehyde.
| Compound Name | 3-bromo-4-(1-methylpyrrolidin-3-yl)benzaldehyde |
|---|---|
| PubChem CID | 83844673 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 3-bromo-4-(1-methylpyrrolidin-3-yl)benzaldehyde |
| SMILES | CN1CCC(c2ccc(C=O)cc2Br)C1 |
| InChI | InChI=1S/C12H14BrNO/c1-14-5-4-10(7-14)11-3-2-9(8-15)6-12(11)13/h2-3,6,8,10H,4-5,7H2,1H3 |
| InChIKey | NOVVILCZSLLYHA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|