About 4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine
4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (PubChem CID 83845803) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| PubChem CID | 83845803 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| SMILES | COc1ncnc2c1CNC2C |
| InChI | InChI=1S/C8H11N3O/c1-5-7-6(3-9-5)8(12-2)11-4-10-7/h4-5,9H,3H2,1-2H3 |
| InChIKey | KHAPDIIWCRCNJA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The IUPAC name of 4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (CID 83845803) is 4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
What is the SMILES notation for 4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The canonical SMILES for 4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is COc1ncnc2c1CNC2C.
What is the InChIKey of 4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The InChIKey is KHAPDIIWCRCNJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-5-7-6(3-9-5)8(12-2)11-4-10-7/h4-5,9H,3H2,1-2H3.
What are the key properties of 4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine has a molecular weight of 165.20 g/mol, XLogP of 0.65, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-7-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is sourced from PubChem (CID 83845803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).