C11H20N2O2 — CID 83848926
methyl 3-methyl-2,8-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 83848926) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is methyl 3-methyl-2,8-diazaspiro[4.5]decane-2-carboxylate.
| Compound Name | methyl 3-methyl-2,8-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 83848926 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | methyl 3-methyl-2,8-diazaspiro[4.5]decane-2-carboxylate |
| SMILES | COC(=O)N1CC2(CCNCC2)CC1C |
| InChI | InChI=1S/C11H20N2O2/c1-9-7-11(3-5-12-6-4-11)8-13(9)10(14)15-2/h9,12H,3-8H2,1-2H3 |
| InChIKey | FDRFDDHNCGTSRZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |