C8H10F3N3O — CID 83849648
6-(2-aminopropyl)-4-(trifluoromethyl)-1H-pyrimidin-2-one (PubChem CID 83849648) has the molecular formula C8H10F3N3O and a molecular weight of 221.18 g/mol. Its IUPAC name is 6-(2-aminopropyl)-4-(trifluoromethyl)-1H-pyrimidin-2-one.
| Compound Name | 6-(2-aminopropyl)-4-(trifluoromethyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 83849648 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 6-(2-aminopropyl)-4-(trifluoromethyl)-1H-pyrimidin-2-one |
| SMILES | CC(N)Cc1cc(C(F)(F)F)nc(=O)[nH]1 |
| InChI | InChI=1S/C8H10F3N3O/c1-4(12)2-5-3-6(8(9,10)11)14-7(15)13-5/h3-4H,2,12H2,1H3,(H,13,14,15) |
| InChIKey | UODNQUZVXWARDU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |