C7H8F2N2O — CID 123325986
4-(1,1-difluoroethyl)-6-methyl-1H-pyrimidin-2-one (PubChem CID 123325986) has the molecular formula C7H8F2N2O and a molecular weight of 174.15 g/mol. Its IUPAC name is 4-(1,1-difluoroethyl)-6-methyl-1H-pyrimidin-2-one.
| Compound Name | 4-(1,1-difluoroethyl)-6-methyl-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 123325986 |
| Molecular Formula | C7H8F2N2O |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 4-(1,1-difluoroethyl)-6-methyl-1H-pyrimidin-2-one |
| SMILES | Cc1cc(C(C)(F)F)nc(=O)[nH]1 |
| InChI | InChI=1S/C7H8F2N2O/c1-4-3-5(7(2,8)9)11-6(12)10-4/h3H,1-2H3,(H,10,11,12) |
| InChIKey | RFHYFKJRPROBDE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |