C11H12FN3O — CID 83849661
7-fluoro-3-piperazin-1-yl-1,2-benzoxazole (PubChem CID 83849661) has the molecular formula C11H12FN3O and a molecular weight of 221.23 g/mol. Its IUPAC name is 7-fluoro-3-piperazin-1-yl-1,2-benzoxazole.
| Compound Name | 7-fluoro-3-piperazin-1-yl-1,2-benzoxazole |
|---|---|
| PubChem CID | 83849661 |
| Molecular Formula | C11H12FN3O |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 7-fluoro-3-piperazin-1-yl-1,2-benzoxazole |
| SMILES | Fc1cccc2c(N3CCNCC3)noc12 |
| InChI | InChI=1S/C11H12FN3O/c12-9-3-1-2-8-10(9)16-14-11(8)15-6-4-13-5-7-15/h1-3,13H,4-7H2 |
| InChIKey | JDLFSXVBOJHXHI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |