About 2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid
2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid (PubChem CID 83849966) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid |
| PubChem CID | 83849966 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid |
| SMILES | CC(C)n1c(CC(=O)O)nc2c1COCC2 |
| InChI | InChI=1S/C11H16N2O3/c1-7(2)13-9-6-16-4-3-8(9)12-10(13)5-11(14)15/h7H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | BLAMOAHIHSFSLN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid?
The IUPAC name of 2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid (CID 83849966) is 2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid.
What is the SMILES notation for 2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid?
The canonical SMILES for 2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid is CC(C)n1c(CC(=O)O)nc2c1COCC2.
What is the InChIKey of 2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid?
The InChIKey is BLAMOAHIHSFSLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-7(2)13-9-6-16-4-3-8(9)12-10(13)5-11(14)15/h7H,3-6H2,1-2H3,(H,14,15).
What are the key properties of 2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid?
2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid has a molecular weight of 224.26 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-propan-2-yl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-yl)acetic acid is sourced from PubChem (CID 83849966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).