C10H11ClN2O2 — CID 83850094
2-(7-chloro-3,4-dihydro-2H-quinoxalin-1-yl)acetic acid (PubChem CID 83850094) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is 2-(7-chloro-3,4-dihydro-2H-quinoxalin-1-yl)acetic acid.
| Compound Name | 2-(7-chloro-3,4-dihydro-2H-quinoxalin-1-yl)acetic acid |
|---|---|
| PubChem CID | 83850094 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-(7-chloro-3,4-dihydro-2H-quinoxalin-1-yl)acetic acid |
| SMILES | O=C(O)CN1CCNc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H11ClN2O2/c11-7-1-2-8-9(5-7)13(4-3-12-8)6-10(14)15/h1-2,5,12H,3-4,6H2,(H,14,15) |
| InChIKey | FLUFIOAJDAEQMA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |