C9H12N2O4 — CID 83852271
3-tert-butyl-2,6-dioxopyrimidine-4-carboxylic acid (PubChem CID 83852271) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 3-tert-butyl-2,6-dioxopyrimidine-4-carboxylic acid.
| Compound Name | 3-tert-butyl-2,6-dioxopyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 83852271 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 3-tert-butyl-2,6-dioxopyrimidine-4-carboxylic acid |
| SMILES | CC(C)(C)n1c(C(=O)O)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C9H12N2O4/c1-9(2,3)11-5(7(13)14)4-6(12)10-8(11)15/h4H,1-3H3,(H,13,14)(H,10,12,15) |
| InChIKey | LCRGWPGFQHPGPW-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |