C9H12N2O5 — CID 90876047
tert-butyl 6-hydroxy-2,4-dioxopyrimidine-1-carboxylate (PubChem CID 90876047) has the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. Its IUPAC name is tert-butyl 6-hydroxy-2,4-dioxopyrimidine-1-carboxylate.
| Compound Name | tert-butyl 6-hydroxy-2,4-dioxopyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 90876047 |
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | tert-butyl 6-hydroxy-2,4-dioxopyrimidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(O)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C9H12N2O5/c1-9(2,3)16-8(15)11-6(13)4-5(12)10-7(11)14/h4,13H,1-3H3,(H,10,12,14) |
| InChIKey | QVSHCPYVCOONOV-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |