C14H14N2O3 — CID 102136452
tert-butyl 4-ethynyl-2-oxo-3H-benzimidazole-1-carboxylate (PubChem CID 102136452) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is tert-butyl 4-ethynyl-2-oxo-3H-benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 4-ethynyl-2-oxo-3H-benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 102136452 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | tert-butyl 4-ethynyl-2-oxo-3H-benzimidazole-1-carboxylate |
| SMILES | C#Cc1cccc2c1[nH]c(=O)n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H14N2O3/c1-5-9-7-6-8-10-11(9)15-12(17)16(10)13(18)19-14(2,3)4/h1,6-8H,2-4H3,(H,15,17) |
| InChIKey | SNBKEDDKYANSMP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|