C13H14N2O4 — CID 54078336
tert-butyl 2,3-dioxo-4H-quinoxaline-1-carboxylate (PubChem CID 54078336) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is tert-butyl 2,3-dioxo-4H-quinoxaline-1-carboxylate.
| Compound Name | tert-butyl 2,3-dioxo-4H-quinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 54078336 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | tert-butyl 2,3-dioxo-4H-quinoxaline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(=O)c(=O)[nH]c2ccccc21 |
| InChI | InChI=1S/C13H14N2O4/c1-13(2,3)19-12(18)15-9-7-5-4-6-8(9)14-10(16)11(15)17/h4-7H,1-3H3,(H,14,16) |
| InChIKey | MLHNPSZEXJNYPC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|