C15H19N3O4S — CID 19380096
tert-butyl [[1-oxo-1-(2-oxo-3H-benzimidazol-1-yl)propan-2-yl]amino]sulfanylformate (PubChem CID 19380096) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is tert-butyl [[1-oxo-1-(2-oxo-3H-benzimidazol-1-yl)propan-2-yl]amino]sulfanylformate.
| Compound Name | tert-butyl [[1-oxo-1-(2-oxo-3H-benzimidazol-1-yl)propan-2-yl]amino]sulfanylformate |
|---|---|
| PubChem CID | 19380096 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | tert-butyl [[1-oxo-1-(2-oxo-3H-benzimidazol-1-yl)propan-2-yl]amino]sulfanylformate |
| SMILES | CC(NSC(=O)OC(C)(C)C)C(=O)n1c(=O)[nH]c2ccccc21 |
| InChI | InChI=1S/C15H19N3O4S/c1-9(17-23-14(21)22-15(2,3)4)12(19)18-11-8-6-5-7-10(11)16-13(18)20/h5-9,17H,1-4H3,(H,16,20) |
| InChIKey | OAVNEGOMXDIMRA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|