2-(6-amino-2-bromopyrimidin-4-yl)acetic acid

C6H6BrN3O2 — CID 83852589

IUPAC2-(6-amino-2-bromopyrimidin-4-yl)acetic acid
SMILESNc1cc(CC(=O)O)nc(Br)n1
InChIInChI=1S/C6H6BrN3O2/c7-6-9-3(2-5(11)12)1-4(8)10-6/h1H,2H2,(H,11,12)(H2,8,9,10)
InChIKeyDGXVVBXWTGIXAV-UHFFFAOYSA-N
MW232.04 g/mol
LogP0.45
Rot. Bonds2

About 2-(6-amino-2-bromopyrimidin-4-yl)acetic acid

2-(6-amino-2-bromopyrimidin-4-yl)acetic acid (PubChem CID 83852589) has the molecular formula C6H6BrN3O2 and a molecular weight of 232.04 g/mol. Its IUPAC name is 2-(6-amino-2-bromopyrimidin-4-yl)acetic acid.

Molecular Properties

Compound Name2-(6-amino-2-bromopyrimidin-4-yl)acetic acid
PubChem CID83852589
Molecular FormulaC6H6BrN3O2
Molecular Weight232.04 g/mol
Exact Mass230.96
IUPAC Name2-(6-amino-2-bromopyrimidin-4-yl)acetic acid
SMILESNc1cc(CC(=O)O)nc(Br)n1
InChIInChI=1S/C6H6BrN3O2/c7-6-9-3(2-5(11)12)1-4(8)10-6/h1H,2H2,(H,11,12)(H2,8,9,10)
InChIKeyDGXVVBXWTGIXAV-UHFFFAOYSA-N
XLogP0.45
TPSA89.10 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.04
LogP ≤ 50.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(6-amino-2-bromopyrimidin-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-amino-2-bromopyrimidin-4-yl)acetic acid?
The IUPAC name of 2-(6-amino-2-bromopyrimidin-4-yl)acetic acid (CID 83852589) is 2-(6-amino-2-bromopyrimidin-4-yl)acetic acid.
What is the SMILES notation for 2-(6-amino-2-bromopyrimidin-4-yl)acetic acid?
The canonical SMILES for 2-(6-amino-2-bromopyrimidin-4-yl)acetic acid is Nc1cc(CC(=O)O)nc(Br)n1.
What is the InChIKey of 2-(6-amino-2-bromopyrimidin-4-yl)acetic acid?
The InChIKey is DGXVVBXWTGIXAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN3O2/c7-6-9-3(2-5(11)12)1-4(8)10-6/h1H,2H2,(H,11,12)(H2,8,9,10).
What are the key properties of 2-(6-amino-2-bromopyrimidin-4-yl)acetic acid?
2-(6-amino-2-bromopyrimidin-4-yl)acetic acid has a molecular weight of 232.04 g/mol, XLogP of 0.45, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-amino-2-bromopyrimidin-4-yl)acetic acid is sourced from PubChem (CID 83852589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).