About 4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine
4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine (PubChem CID 83862337) has the molecular formula C9H15N5
and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine |
| PubChem CID | 83862337 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine |
| SMILES | CN1Cc2nc(N)nc(CCN)c2C1 |
| InChI | InChI=1S/C9H15N5/c1-14-4-6-7(2-3-10)12-9(11)13-8(6)5-14/h2-5,10H2,1H3,(H2,11,12,13) |
| InChIKey | RNRZZVLOPOCAQK-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine?
The IUPAC name of 4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine (CID 83862337) is 4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine.
What is the SMILES notation for 4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine?
The canonical SMILES for 4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine is CN1Cc2nc(N)nc(CCN)c2C1.
What is the InChIKey of 4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine?
The InChIKey is RNRZZVLOPOCAQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5/c1-14-4-6-7(2-3-10)12-9(11)13-8(6)5-14/h2-5,10H2,1H3,(H2,11,12,13).
What are the key properties of 4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine?
4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine has a molecular weight of 193.25 g/mol, XLogP of -0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-6-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-amine is sourced from PubChem (CID 83862337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).