C8H13BrN4 — CID 83867915
1-(3-bromo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-N-methylmethanamine (PubChem CID 83867915) has the molecular formula C8H13BrN4 and a molecular weight of 245.12 g/mol. Its IUPAC name is 1-(3-bromo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-N-methylmethanamine.
| Compound Name | 1-(3-bromo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 83867915 |
| Molecular Formula | C8H13BrN4 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 1-(3-bromo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-N-methylmethanamine |
| SMILES | CNCC1CCc2nnc(Br)n2C1 |
| InChI | InChI=1S/C8H13BrN4/c1-10-4-6-2-3-7-11-12-8(9)13(7)5-6/h6,10H,2-5H2,1H3 |
| InChIKey | HOQKRMSDQLZCIJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |