C10H10Cl2N2 — CID 83868356
(4,7-dichloro-1-methylindol-2-yl)methanamine (PubChem CID 83868356) has the molecular formula C10H10Cl2N2 and a molecular weight of 229.11 g/mol. Its IUPAC name is (4,7-dichloro-1-methylindol-2-yl)methanamine.
| Compound Name | (4,7-dichloro-1-methylindol-2-yl)methanamine |
|---|---|
| PubChem CID | 83868356 |
| Molecular Formula | C10H10Cl2N2 |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | (4,7-dichloro-1-methylindol-2-yl)methanamine |
| SMILES | Cn1c(CN)cc2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C10H10Cl2N2/c1-14-6(5-13)4-7-8(11)2-3-9(12)10(7)14/h2-4H,5,13H2,1H3 |
| InChIKey | FBYRPNHBJOHFMH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |