C9H10ClN3 — CID 83869471
1-(5-chloroimidazo[1,5-a]pyridin-1-yl)-N-methylmethanamine (PubChem CID 83869471) has the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. Its IUPAC name is 1-(5-chloroimidazo[1,5-a]pyridin-1-yl)-N-methylmethanamine.
| Compound Name | 1-(5-chloroimidazo[1,5-a]pyridin-1-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 83869471 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 1-(5-chloroimidazo[1,5-a]pyridin-1-yl)-N-methylmethanamine |
| SMILES | CNCc1ncn2c(Cl)cccc12 |
| InChI | InChI=1S/C9H10ClN3/c1-11-5-7-8-3-2-4-9(10)13(8)6-12-7/h2-4,6,11H,5H2,1H3 |
| InChIKey | NMQOJFRDBHTSAL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|