C8H13ClN4 — CID 83870174
1-(3-chloro-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl)-N-methylmethanamine (PubChem CID 83870174) has the molecular formula C8H13ClN4 and a molecular weight of 200.67 g/mol. Its IUPAC name is 1-(3-chloro-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl)-N-methylmethanamine.
| Compound Name | 1-(3-chloro-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 83870174 |
| Molecular Formula | C8H13ClN4 |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1-(3-chloro-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl)-N-methylmethanamine |
| SMILES | CNCC1CCCn2c(Cl)nnc21 |
| InChI | InChI=1S/C8H13ClN4/c1-10-5-6-3-2-4-13-7(6)11-12-8(13)9/h6,10H,2-5H2,1H3 |
| InChIKey | GBFXVDZPZRSPKQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |