C7H9N3OS — CID 83871405
4-(aminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione (PubChem CID 83871405) has the molecular formula C7H9N3OS and a molecular weight of 183.24 g/mol. Its IUPAC name is 4-(aminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione.
| Compound Name | 4-(aminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 83871405 |
| Molecular Formula | C7H9N3OS |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 4-(aminomethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione |
| SMILES | NCc1nc(=S)[nH]c2c1COC2 |
| InChI | InChI=1S/C7H9N3OS/c8-1-5-4-2-11-3-6(4)10-7(12)9-5/h1-3,8H2,(H,9,10,12) |
| InChIKey | FVCXHCKYNLHGBC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|