C8H8N2O2S — CID 83871751
2-oxo-1,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidine-4-carbaldehyde (PubChem CID 83871751) has the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. Its IUPAC name is 2-oxo-1,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidine-4-carbaldehyde.
| Compound Name | 2-oxo-1,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 83871751 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 2-oxo-1,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidine-4-carbaldehyde |
| SMILES | O=Cc1nc(=O)[nH]c2c1CSCC2 |
| InChI | InChI=1S/C8H8N2O2S/c11-3-7-5-4-13-2-1-6(5)9-8(12)10-7/h3H,1-2,4H2,(H,9,10,12) |
| InChIKey | YCERVBZZPXQZKS-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|