C6H13N5 — CID 83872825
5-(2-aminopropyl)-N-methyl-1H-1,2,4-triazol-3-amine (PubChem CID 83872825) has the molecular formula C6H13N5 and a molecular weight of 155.20 g/mol. Its IUPAC name is 5-(2-aminopropyl)-N-methyl-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(2-aminopropyl)-N-methyl-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 83872825 |
| Molecular Formula | C6H13N5 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.12 |
| IUPAC Name | 5-(2-aminopropyl)-N-methyl-1H-1,2,4-triazol-3-amine |
| SMILES | CNc1n[nH]c(CC(C)N)n1 |
| InChI | InChI=1S/C6H13N5/c1-4(7)3-5-9-6(8-2)11-10-5/h4H,3,7H2,1-2H3,(H2,8,9,10,11) |
| InChIKey | CTCKZKAFNNKPPQ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |