C11H15N3 — CID 83877282
3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine (PubChem CID 83877282) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine.
| Compound Name | 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 83877282 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine |
| SMILES | CCc1nc(C)c2ccc(NC)cn12 |
| InChI | InChI=1S/C11H15N3/c1-4-11-13-8(2)10-6-5-9(12-3)7-14(10)11/h5-7,12H,4H2,1-3H3 |
| InChIKey | KNXPHZYEDWRZAG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |