About 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine
3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine (PubChem CID 83877282) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine.
Molecular Properties
| Compound Name | 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine |
| PubChem CID | 83877282 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine |
| SMILES | CCc1nc(C)c2ccc(NC)cn12 |
| InChI | InChI=1S/C11H15N3/c1-4-11-13-8(2)10-6-5-9(12-3)7-14(10)11/h5-7,12H,4H2,1-3H3 |
| InChIKey | KNXPHZYEDWRZAG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine?
The IUPAC name of 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine (CID 83877282) is 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine.
What is the SMILES notation for 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine?
The canonical SMILES for 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine is CCc1nc(C)c2ccc(NC)cn12.
What is the InChIKey of 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine?
The InChIKey is KNXPHZYEDWRZAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-4-11-13-8(2)10-6-5-9(12-3)7-14(10)11/h5-7,12H,4H2,1-3H3.
What are the key properties of 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine?
3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine has a molecular weight of 189.26 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N,1-dimethylimidazo[1,5-a]pyridin-6-amine is sourced from PubChem (CID 83877282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).