C9H9N3S — CID 83877838
2-(1,2-benzothiazol-4-yl)ethanimidamide (PubChem CID 83877838) has the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. Its IUPAC name is 2-(1,2-benzothiazol-4-yl)ethanimidamide.
| Compound Name | 2-(1,2-benzothiazol-4-yl)ethanimidamide |
|---|---|
| PubChem CID | 83877838 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 2-(1,2-benzothiazol-4-yl)ethanimidamide |
| SMILES | [H]/N=C(\N)Cc1cccc2sncc12 |
| InChI | InChI=1S/C9H9N3S/c10-9(11)4-6-2-1-3-8-7(6)5-12-13-8/h1-3,5H,4H2,(H3,10,11) |
| InChIKey | VYHMLFLYRBBUBP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|