C10H16N2O2 — CID 83879909
1-cyclobutyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one (PubChem CID 83879909) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-cyclobutyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one.
| Compound Name | 1-cyclobutyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 83879909 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-cyclobutyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one |
| SMILES | O=C1OCC2(CCNC2)N1C1CCC1 |
| InChI | InChI=1S/C10H16N2O2/c13-9-12(8-2-1-3-8)10(7-14-9)4-5-11-6-10/h8,11H,1-7H2 |
| InChIKey | ZNBITRCJTITSKB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |