C10H18N2O2 — CID 83880329
1-tert-butyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one (PubChem CID 83880329) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-tert-butyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one.
| Compound Name | 1-tert-butyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 83880329 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-tert-butyl-3-oxa-1,7-diazaspiro[4.4]nonan-2-one |
| SMILES | CC(C)(C)N1C(=O)OCC12CCNC2 |
| InChI | InChI=1S/C10H18N2O2/c1-9(2,3)12-8(13)14-7-10(12)4-5-11-6-10/h11H,4-7H2,1-3H3 |
| InChIKey | RXRWNUXBHQPXCW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |