About 1-(2-ethylsulfanyl-4-methyl-1,3-thiazol-5-yl)ethanone
1-(2-ethylsulfanyl-4-methyl-1,3-thiazol-5-yl)ethanone (PubChem CID 83881059) has the molecular formula C8H11NOS2
and a molecular weight of 201.32 g/mol. Its IUPAC name is 1-(2-ethylsulfanyl-4-methyl-1,3-thiazol-5-yl)ethanone.
Analyze 1-(2-ethylsulfanyl-4-methyl-1,3-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethylsulfanyl-4-methyl-1,3-thiazol-5-yl)ethanone?
The IUPAC name of 1-(2-ethylsulfanyl-4-methyl-1,3-thiazol-5-yl)ethanone (CID 83881059) is 1-(2-ethylsulfanyl-4-methyl-1,3-thiazol-5-yl)ethanone.
What is the SMILES notation for 1-(2-ethylsulfanyl-4-methyl-1,3-thiazol-5-yl)ethanone?
The canonical SMILES for 1-(2-ethylsulfanyl-4-methyl-1,3-thiazol-5-yl)ethanone is CCSc1nc(C)c(C(C)=O)s1.
What is the InChIKey of 1-(2-ethylsulfanyl-4-methyl-1,3-thiazol-5-yl)ethanone?
The InChIKey is LFHGYBGXEXRYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NOS2/c1-4-11-8-9-5(2)7(12-8)6(3)10/h4H2,1-3H3.
What are the key properties of 1-(2-ethylsulfanyl-4-methyl-1,3-thiazol-5-yl)ethanone?
1-(2-ethylsulfanyl-4-methyl-1,3-thiazol-5-yl)ethanone has a molecular weight of 201.32 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethylsulfanyl-4-methyl-1,3-thiazol-5-yl)ethanone is sourced from PubChem (CID 83881059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).