C10H9N3O2 — CID 83881402
4-(4-methylphenyl)-1,2,4-triazole-3-carboxylic acid (PubChem CID 83881402) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1,2,4-triazole-3-carboxylic acid.
| Compound Name | 4-(4-methylphenyl)-1,2,4-triazole-3-carboxylic acid |
|---|---|
| PubChem CID | 83881402 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 4-(4-methylphenyl)-1,2,4-triazole-3-carboxylic acid |
| SMILES | Cc1ccc(-n2cnnc2C(=O)O)cc1 |
| InChI | InChI=1S/C10H9N3O2/c1-7-2-4-8(5-3-7)13-6-11-12-9(13)10(14)15/h2-6H,1H3,(H,14,15) |
| InChIKey | YZZMILIHTIALLD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |