C9H6FN3O2 — CID 83883043
4-(2-fluorophenyl)-1,2,4-triazole-3-carboxylic acid (PubChem CID 83883043) has the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-1,2,4-triazole-3-carboxylic acid.
| Compound Name | 4-(2-fluorophenyl)-1,2,4-triazole-3-carboxylic acid |
|---|---|
| PubChem CID | 83883043 |
| Molecular Formula | C9H6FN3O2 |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 4-(2-fluorophenyl)-1,2,4-triazole-3-carboxylic acid |
| SMILES | O=C(O)c1nncn1-c1ccccc1F |
| InChI | InChI=1S/C9H6FN3O2/c10-6-3-1-2-4-7(6)13-5-11-12-8(13)9(14)15/h1-5H,(H,14,15) |
| InChIKey | FVTWODNIKPYCEI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |