C4H6BrN3S — CID 83883572
2-(5-bromo-1,2,4-thiadiazol-3-yl)ethanamine (PubChem CID 83883572) has the molecular formula C4H6BrN3S and a molecular weight of 208.08 g/mol. Its IUPAC name is 2-(5-bromo-1,2,4-thiadiazol-3-yl)ethanamine.
| Compound Name | 2-(5-bromo-1,2,4-thiadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 83883572 |
| Molecular Formula | C4H6BrN3S |
| Molecular Weight | 208.08 g/mol |
| Exact Mass | 206.95 |
| IUPAC Name | 2-(5-bromo-1,2,4-thiadiazol-3-yl)ethanamine |
| SMILES | NCCc1nsc(Br)n1 |
| InChI | InChI=1S/C4H6BrN3S/c5-4-7-3(1-2-6)8-9-4/h1-2,6H2 |
| InChIKey | PPFDVKJXRBXJOO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.08 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |