C5H6Cl2N4 — CID 57174949
2-(4,6-dichloro-1,3,5-triazin-2-yl)ethanamine (PubChem CID 57174949) has the molecular formula C5H6Cl2N4 and a molecular weight of 193.04 g/mol. Its IUPAC name is 2-(4,6-dichloro-1,3,5-triazin-2-yl)ethanamine.
| Compound Name | 2-(4,6-dichloro-1,3,5-triazin-2-yl)ethanamine |
|---|---|
| PubChem CID | 57174949 |
| Molecular Formula | C5H6Cl2N4 |
| Molecular Weight | 193.04 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | 2-(4,6-dichloro-1,3,5-triazin-2-yl)ethanamine |
| SMILES | NCCc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C5H6Cl2N4/c6-4-9-3(1-2-8)10-5(7)11-4/h1-2,8H2 |
| InChIKey | UKKKDSGSIRIFCW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.04 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |