C7H8ClF3N4O — CID 103213749
4-chloro-6-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,5-triazin-2-amine (PubChem CID 103213749) has the molecular formula C7H8ClF3N4O and a molecular weight of 256.61 g/mol. Its IUPAC name is 4-chloro-6-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 103213749 |
| Molecular Formula | C7H8ClF3N4O |
| Molecular Weight | 256.61 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 4-chloro-6-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cl)nc(CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C7H8ClF3N4O/c8-5-13-4(14-6(12)15-5)1-2-16-3-7(9,10)11/h1-3H2,(H2,12,13,14,15) |
| InChIKey | LJKNNWQTVMHUOT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.61 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|