C11H13BrClF3N2O — CID 103146715
5-bromo-4-chloro-6-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine (PubChem CID 103146715) has the molecular formula C11H13BrClF3N2O and a molecular weight of 361.59 g/mol. Its IUPAC name is 5-bromo-4-chloro-6-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine.
| Compound Name | 5-bromo-4-chloro-6-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine |
|---|---|
| PubChem CID | 103146715 |
| Molecular Formula | C11H13BrClF3N2O |
| Molecular Weight | 361.59 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 5-bromo-4-chloro-6-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine |
| SMILES | CCCc1nc(CCOCC(F)(F)F)nc(Cl)c1Br |
| InChI | InChI=1S/C11H13BrClF3N2O/c1-2-3-7-9(12)10(13)18-8(17-7)4-5-19-6-11(14,15)16/h2-6H2,1H3 |
| InChIKey | PCBYZXDOKSTPAE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|