C8H11F3N4OS — CID 103206958
4-methylsulfanyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,5-triazin-2-amine (PubChem CID 103206958) has the molecular formula C8H11F3N4OS and a molecular weight of 268.26 g/mol. Its IUPAC name is 4-methylsulfanyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-methylsulfanyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 103206958 |
| Molecular Formula | C8H11F3N4OS |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 4-methylsulfanyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,5-triazin-2-amine |
| SMILES | CSc1nc(N)nc(CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H11F3N4OS/c1-17-7-14-5(13-6(12)15-7)2-3-16-4-8(9,10)11/h2-4H2,1H3,(H2,12,13,14,15) |
| InChIKey | OAORJYBMOUGGIB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|