2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid

C11H16N2O2 — CID 83883906

IUPAC2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid
SMILESCc1cnc(CC(=O)O)n1C1CCCC1
InChIInChI=1S/C11H16N2O2/c1-8-7-12-10(6-11(14)15)13(8)9-4-2-3-5-9/h7,9H,2-6H2,1H3,(H,14,15)
InChIKeyOWSQIMSHXGYFPV-UHFFFAOYSA-N
MW208.26 g/mol
LogP1.93
Rot. Bonds3

About 2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid

2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid (PubChem CID 83883906) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid.

Molecular Properties

Compound Name2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid
PubChem CID83883906
Molecular FormulaC11H16N2O2
Molecular Weight208.26 g/mol
Exact Mass208.12
IUPAC Name2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid
SMILESCc1cnc(CC(=O)O)n1C1CCCC1
InChIInChI=1S/C11H16N2O2/c1-8-7-12-10(6-11(14)15)13(8)9-4-2-3-5-9/h7,9H,2-6H2,1H3,(H,14,15)
InChIKeyOWSQIMSHXGYFPV-UHFFFAOYSA-N
XLogP1.93
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.26
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(1-cyclobutyl-5-methylimidazol-2-yl)propanoic acid
CID 83883905
N-[2-(1-cyclooctyl-5-methylimidazol-2-yl)ethyl]acetamide
CID 110203803
2-(1-cyclopentyl-5-methylpyrazol-4-yl)acetic acid
CID 83883737
2-(5-methylimidazo[1,5-a]pyridin-3-yl)acetic acid
CID 83829431
2-(5-cyclobutyl-1-methylimidazol-2-yl)acetic acid
CID 83847445
2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid
CID 83892882
2-(1-cyclopentyl-6-methyl-2-oxo-3-pyridinyl)acetyl chloride
CID 82524860
2-(1-cyclobutyl-3-methylpyrazol-4-yl)acetic acid
CID 112712810
N-[2-(1-cyclopropyl-5-methylimidazol-2-yl)ethyl]-1-methylimidazole-4-carboxamide
CID 91923835
N-[2-(1-cyclobutyl-5-methylimidazol-2-yl)ethyl]-4-oxo-3H-phthalazine-1-carboxamide
CID 91911669
2-(1-cyclohexyl-5-ethylimidazol-2-yl)sulfanylacetic acid
CID 81337465
5-bromo-1-cyclopentylimidazole-2-carboxylic acid
CID 83901767

Frequently Asked Questions

What is the IUPAC name of 2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid?
The IUPAC name of 2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid (CID 83883906) is 2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid.
What is the SMILES notation for 2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid?
The canonical SMILES for 2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid is Cc1cnc(CC(=O)O)n1C1CCCC1.
What is the InChIKey of 2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid?
The InChIKey is OWSQIMSHXGYFPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-8-7-12-10(6-11(14)15)13(8)9-4-2-3-5-9/h7,9H,2-6H2,1H3,(H,14,15).
What are the key properties of 2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid?
2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid has a molecular weight of 208.26 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclopentyl-5-methylimidazol-2-yl)acetic acid is sourced from PubChem (CID 83883906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).