About 2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid
2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid (PubChem CID 83892882) has the molecular formula C9H13N3O2S
and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid |
| PubChem CID | 83892882 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid |
| SMILES | CSc1nnc(CC(=O)O)n1C1CCC1 |
| InChI | InChI=1S/C9H13N3O2S/c1-15-9-11-10-7(5-8(13)14)12(9)6-3-2-4-6/h6H,2-5H2,1H3,(H,13,14) |
| InChIKey | KESFZJPGBGIVMH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid?
The IUPAC name of 2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid (CID 83892882) is 2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid.
What is the SMILES notation for 2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid?
The canonical SMILES for 2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid is CSc1nnc(CC(=O)O)n1C1CCC1.
What is the InChIKey of 2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid?
The InChIKey is KESFZJPGBGIVMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2S/c1-15-9-11-10-7(5-8(13)14)12(9)6-3-2-4-6/h6H,2-5H2,1H3,(H,13,14).
What are the key properties of 2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid?
2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid has a molecular weight of 227.29 g/mol, XLogP of 1.35, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclobutyl-5-methylsulfanyl-1,2,4-triazol-3-yl)acetic acid is sourced from PubChem (CID 83892882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).