C9H9ClN4 — CID 83884204
2-(1-chloroimidazo[1,5-a]pyridin-7-yl)ethanimidamide (PubChem CID 83884204) has the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. Its IUPAC name is 2-(1-chloroimidazo[1,5-a]pyridin-7-yl)ethanimidamide.
| Compound Name | 2-(1-chloroimidazo[1,5-a]pyridin-7-yl)ethanimidamide |
|---|---|
| PubChem CID | 83884204 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-(1-chloroimidazo[1,5-a]pyridin-7-yl)ethanimidamide |
| SMILES | [H]/N=C(\N)Cc1ccn2cnc(Cl)c2c1 |
| InChI | InChI=1S/C9H9ClN4/c10-9-7-3-6(4-8(11)12)1-2-14(7)5-13-9/h1-3,5H,4H2,(H3,11,12) |
| InChIKey | UEDXITUCZPWWJX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|