C11H15NO3 — CID 83884346
3-[2-(methoxymethyl)-4-pyridinyl]-2-methylpropanoic acid (PubChem CID 83884346) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 3-[2-(methoxymethyl)-4-pyridinyl]-2-methylpropanoic acid.
| Compound Name | 3-[2-(methoxymethyl)-4-pyridinyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 83884346 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 3-[2-(methoxymethyl)-4-pyridinyl]-2-methylpropanoic acid |
| SMILES | COCc1cc(CC(C)C(=O)O)ccn1 |
| InChI | InChI=1S/C11H15NO3/c1-8(11(13)14)5-9-3-4-12-10(6-9)7-15-2/h3-4,6,8H,5,7H2,1-2H3,(H,13,14) |
| InChIKey | XPWNJAHWSUSOKE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |