C10H13ClN2O — CID 83885946
1-chloro-3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-8-carbaldehyde (PubChem CID 83885946) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is 1-chloro-3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-8-carbaldehyde.
| Compound Name | 1-chloro-3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-8-carbaldehyde |
|---|---|
| PubChem CID | 83885946 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 1-chloro-3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-8-carbaldehyde |
| SMILES | CCc1nc(Cl)c2n1CCCC2C=O |
| InChI | InChI=1S/C10H13ClN2O/c1-2-8-12-10(11)9-7(6-14)4-3-5-13(8)9/h6-7H,2-5H2,1H3 |
| InChIKey | IUTTUEIKMAZOKG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|