C9H13N3O — CID 83875146
3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbaldehyde (PubChem CID 83875146) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbaldehyde.
| Compound Name | 3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbaldehyde |
|---|---|
| PubChem CID | 83875146 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbaldehyde |
| SMILES | CCc1nnc2n1CC(C=O)CC2 |
| InChI | InChI=1S/C9H13N3O/c1-2-8-10-11-9-4-3-7(6-13)5-12(8)9/h6-7H,2-5H2,1H3 |
| InChIKey | AJNKILFABFVFPI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|