About 3-cinnolin-4-ylbutanoic acid
3-cinnolin-4-ylbutanoic acid (PubChem CID 83887029) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 3-cinnolin-4-ylbutanoic acid.
Molecular Properties
| Compound Name | 3-cinnolin-4-ylbutanoic acid |
| PubChem CID | 83887029 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-cinnolin-4-ylbutanoic acid |
| SMILES | CC(CC(=O)O)c1cnnc2ccccc12 |
| InChI | InChI=1S/C12H12N2O2/c1-8(6-12(15)16)10-7-13-14-11-5-3-2-4-9(10)11/h2-5,7-8H,6H2,1H3,(H,15,16) |
| InChIKey | VUNKVQFNONZKFV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cinnolin-4-ylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cinnolin-4-ylbutanoic acid?
The IUPAC name of 3-cinnolin-4-ylbutanoic acid (CID 83887029) is 3-cinnolin-4-ylbutanoic acid.
What is the SMILES notation for 3-cinnolin-4-ylbutanoic acid?
The canonical SMILES for 3-cinnolin-4-ylbutanoic acid is CC(CC(=O)O)c1cnnc2ccccc12.
What is the InChIKey of 3-cinnolin-4-ylbutanoic acid?
The InChIKey is VUNKVQFNONZKFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c1-8(6-12(15)16)10-7-13-14-11-5-3-2-4-9(10)11/h2-5,7-8H,6H2,1H3,(H,15,16).
What are the key properties of 3-cinnolin-4-ylbutanoic acid?
3-cinnolin-4-ylbutanoic acid has a molecular weight of 216.24 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cinnolin-4-ylbutanoic acid is sourced from PubChem (CID 83887029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).