About 4-ethylcinnoline
4-ethylcinnoline (PubChem CID 54530021) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 4-ethylcinnoline.
Molecular Properties
| Compound Name | 4-ethylcinnoline |
| PubChem CID | 54530021 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 4-ethylcinnoline |
| SMILES | CCc1cnnc2ccccc12 |
| InChI | InChI=1S/C10H10N2/c1-2-8-7-11-12-10-6-4-3-5-9(8)10/h3-7H,2H2,1H3 |
| InChIKey | LLWKPRXVZVGIGR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethylcinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylcinnoline?
The IUPAC name of 4-ethylcinnoline (CID 54530021) is 4-ethylcinnoline.
What is the SMILES notation for 4-ethylcinnoline?
The canonical SMILES for 4-ethylcinnoline is CCc1cnnc2ccccc12.
What is the InChIKey of 4-ethylcinnoline?
The InChIKey is LLWKPRXVZVGIGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-2-8-7-11-12-10-6-4-3-5-9(8)10/h3-7H,2H2,1H3.
What are the key properties of 4-ethylcinnoline?
4-ethylcinnoline has a molecular weight of 158.20 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylcinnoline is sourced from PubChem (CID 54530021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).