About 4-ethylpyrido[3,4-c]pyridazine
4-ethylpyrido[3,4-c]pyridazine (PubChem CID 156710783) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 4-ethylpyrido[3,4-c]pyridazine.
Molecular Properties
| Compound Name | 4-ethylpyrido[3,4-c]pyridazine |
| PubChem CID | 156710783 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 4-ethylpyrido[3,4-c]pyridazine |
| SMILES | CCc1cnnc2cnccc12 |
| InChI | InChI=1S/C9H9N3/c1-2-7-5-11-12-9-6-10-4-3-8(7)9/h3-6H,2H2,1H3 |
| InChIKey | MQGQLFRCYFSJBY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethylpyrido[3,4-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylpyrido[3,4-c]pyridazine?
The IUPAC name of 4-ethylpyrido[3,4-c]pyridazine (CID 156710783) is 4-ethylpyrido[3,4-c]pyridazine.
What is the SMILES notation for 4-ethylpyrido[3,4-c]pyridazine?
The canonical SMILES for 4-ethylpyrido[3,4-c]pyridazine is CCc1cnnc2cnccc12.
What is the InChIKey of 4-ethylpyrido[3,4-c]pyridazine?
The InChIKey is MQGQLFRCYFSJBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c1-2-7-5-11-12-9-6-10-4-3-8(7)9/h3-6H,2H2,1H3.
What are the key properties of 4-ethylpyrido[3,4-c]pyridazine?
4-ethylpyrido[3,4-c]pyridazine has a molecular weight of 159.19 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylpyrido[3,4-c]pyridazine is sourced from PubChem (CID 156710783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).