About cinnolin-4-amine;hydrochloride
cinnolin-4-amine;hydrochloride (PubChem CID 171504338) has the molecular formula C8H8ClN3
and a molecular weight of 181.63 g/mol. Its IUPAC name is cinnolin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | cinnolin-4-amine;hydrochloride |
| PubChem CID | 171504338 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | cinnolin-4-amine;hydrochloride |
| SMILES | Cl.Nc1cnnc2ccccc12 |
| InChI | InChI=1S/C8H7N3.ClH/c9-7-5-10-11-8-4-2-1-3-6(7)8;/h1-5H,(H2,9,11);1H |
| InChIKey | QRJSVYYNNPRKKW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cinnolin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cinnolin-4-amine;hydrochloride?
The IUPAC name of cinnolin-4-amine;hydrochloride (CID 171504338) is cinnolin-4-amine;hydrochloride.
What is the SMILES notation for cinnolin-4-amine;hydrochloride?
The canonical SMILES for cinnolin-4-amine;hydrochloride is Cl.Nc1cnnc2ccccc12.
What is the InChIKey of cinnolin-4-amine;hydrochloride?
The InChIKey is QRJSVYYNNPRKKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.ClH/c9-7-5-10-11-8-4-2-1-3-6(7)8;/h1-5H,(H2,9,11);1H.
What are the key properties of cinnolin-4-amine;hydrochloride?
cinnolin-4-amine;hydrochloride has a molecular weight of 181.63 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cinnolin-4-amine;hydrochloride is sourced from PubChem (CID 171504338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).